C15H26N4OS — CID 82457438
2-(methoxymethyl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione (PubChem CID 82457438) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione.
| Compound Name | 2-(methoxymethyl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457438 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-(methoxymethyl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione |
| SMILES | COCc1nc(=S)cc(NC2CC(C)(C)NC(C)(C)C2)[nH]1 |
| InChI | InChI=1S/C15H26N4OS/c1-14(2)7-10(8-15(3,4)19-14)16-11-6-13(21)18-12(17-11)9-20-5/h6,10,19H,7-9H2,1-5H3,(H2,16,17,18,21) |
| InChIKey | RNCLMUBORLUPNC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|