C14H25N3OS — CID 82457446
2-(methoxymethyl)-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione (PubChem CID 82457446) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione.
| Compound Name | 2-(methoxymethyl)-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457446 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-(methoxymethyl)-6-(2,4,4-trimethylpentan-2-ylamino)-1H-pyrimidine-4-thione |
| SMILES | COCc1nc(=S)cc(NC(C)(C)CC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C14H25N3OS/c1-13(2,3)9-14(4,5)17-10-7-12(19)16-11(15-10)8-18-6/h7H,8-9H2,1-6H3,(H2,15,16,17,19) |
| InChIKey | ZFIKQHVQMHYZFX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|