C11H17N3O2S — CID 82457463
2-(methoxymethyl)-6-(oxolan-2-ylmethylamino)-1H-pyrimidine-4-thione (PubChem CID 82457463) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-(oxolan-2-ylmethylamino)-1H-pyrimidine-4-thione.
| Compound Name | 2-(methoxymethyl)-6-(oxolan-2-ylmethylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457463 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-(methoxymethyl)-6-(oxolan-2-ylmethylamino)-1H-pyrimidine-4-thione |
| SMILES | COCc1nc(=S)cc(NCC2CCCO2)[nH]1 |
| InChI | InChI=1S/C11H17N3O2S/c1-15-7-10-13-9(5-11(17)14-10)12-6-8-3-2-4-16-8/h5,8H,2-4,6-7H2,1H3,(H2,12,13,14,17) |
| InChIKey | GGTXBDHQFDKFMC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|