C15H25N3OS — CID 82457557
2-cyclohexyl-6-(3-ethoxypropylamino)-1H-pyrimidine-4-thione (PubChem CID 82457557) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is 2-cyclohexyl-6-(3-ethoxypropylamino)-1H-pyrimidine-4-thione.
| Compound Name | 2-cyclohexyl-6-(3-ethoxypropylamino)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457557 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-cyclohexyl-6-(3-ethoxypropylamino)-1H-pyrimidine-4-thione |
| SMILES | CCOCCCNc1cc(=S)nc(C2CCCCC2)[nH]1 |
| InChI | InChI=1S/C15H25N3OS/c1-2-19-10-6-9-16-13-11-14(20)18-15(17-13)12-7-4-3-5-8-12/h11-12H,2-10H2,1H3,(H2,16,17,18,20) |
| InChIKey | UXCLBYTVEGUKPM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|