C16H21N3OS — CID 82457676
6-[(4-methoxyphenyl)methylamino]-2-(2-methylpropyl)-1H-pyrimidine-4-thione (PubChem CID 82457676) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methylamino]-2-(2-methylpropyl)-1H-pyrimidine-4-thione.
| Compound Name | 6-[(4-methoxyphenyl)methylamino]-2-(2-methylpropyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457676 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 6-[(4-methoxyphenyl)methylamino]-2-(2-methylpropyl)-1H-pyrimidine-4-thione |
| SMILES | COc1ccc(CNc2cc(=S)nc(CC(C)C)[nH]2)cc1 |
| InChI | InChI=1S/C16H21N3OS/c1-11(2)8-15-18-14(9-16(21)19-15)17-10-12-4-6-13(20-3)7-5-12/h4-7,9,11H,8,10H2,1-3H3,(H2,17,18,19,21) |
| InChIKey | WPIFQVSJARWMLK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|