C16H18FN3O2 — CID 82457717
N-[(4-fluorophenyl)methyl]-6-methoxy-2-(oxolan-2-yl)pyrimidin-4-amine (PubChem CID 82457717) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6-methoxy-2-(oxolan-2-yl)pyrimidin-4-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-6-methoxy-2-(oxolan-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 82457717 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6-methoxy-2-(oxolan-2-yl)pyrimidin-4-amine |
| SMILES | COc1cc(NCc2ccc(F)cc2)nc(C2CCCO2)n1 |
| InChI | InChI=1S/C16H18FN3O2/c1-21-15-9-14(18-10-11-4-6-12(17)7-5-11)19-16(20-15)13-3-2-8-22-13/h4-7,9,13H,2-3,8,10H2,1H3,(H,18,19,20) |
| InChIKey | XYTJLHQUBSRWAM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |