C17H32N4O — CID 82457973
N',N'-diethyl-N-[6-methoxy-2-(2-methylpropyl)pyrimidin-4-yl]butane-1,4-diamine (PubChem CID 82457973) has the molecular formula C17H32N4O and a molecular weight of 308.47 g/mol. Its IUPAC name is N',N'-diethyl-N-[6-methoxy-2-(2-methylpropyl)pyrimidin-4-yl]butane-1,4-diamine.
| Compound Name | N',N'-diethyl-N-[6-methoxy-2-(2-methylpropyl)pyrimidin-4-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 82457973 |
| Molecular Formula | C17H32N4O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | N',N'-diethyl-N-[6-methoxy-2-(2-methylpropyl)pyrimidin-4-yl]butane-1,4-diamine |
| SMILES | CCN(CC)CCCCNc1cc(OC)nc(CC(C)C)n1 |
| InChI | InChI=1S/C17H32N4O/c1-6-21(7-2)11-9-8-10-18-15-13-17(22-5)20-16(19-15)12-14(3)4/h13-14H,6-12H2,1-5H3,(H,18,19,20) |
| InChIKey | UVLRPLPFOKWIAX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|