C16H30N4O2 — CID 82458644
4-N-hexyl-2-(methoxymethyl)-6-(2-methylpropoxy)pyrimidine-4,5-diamine (PubChem CID 82458644) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-N-hexyl-2-(methoxymethyl)-6-(2-methylpropoxy)pyrimidine-4,5-diamine.
| Compound Name | 4-N-hexyl-2-(methoxymethyl)-6-(2-methylpropoxy)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82458644 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 4-N-hexyl-2-(methoxymethyl)-6-(2-methylpropoxy)pyrimidine-4,5-diamine |
| SMILES | CCCCCCNc1nc(COC)nc(OCC(C)C)c1N |
| InChI | InChI=1S/C16H30N4O2/c1-5-6-7-8-9-18-15-14(17)16(22-10-12(2)3)20-13(19-15)11-21-4/h12H,5-11,17H2,1-4H3,(H,18,19,20) |
| InChIKey | PBEOCRLTZGGYMY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|