C14H21ClN4O — CID 82459549
6-chloro-4-N-cyclohexyl-2-(oxolan-2-yl)pyrimidine-4,5-diamine (PubChem CID 82459549) has the molecular formula C14H21ClN4O and a molecular weight of 296.80 g/mol. Its IUPAC name is 6-chloro-4-N-cyclohexyl-2-(oxolan-2-yl)pyrimidine-4,5-diamine.
| Compound Name | 6-chloro-4-N-cyclohexyl-2-(oxolan-2-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 82459549 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 6-chloro-4-N-cyclohexyl-2-(oxolan-2-yl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Cl)nc(C2CCCO2)nc1NC1CCCCC1 |
| InChI | InChI=1S/C14H21ClN4O/c15-12-11(16)14(17-9-5-2-1-3-6-9)19-13(18-12)10-7-4-8-20-10/h9-10H,1-8,16H2,(H,17,18,19) |
| InChIKey | XIXLZAWLYLAKRW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |