C11H22N4O2S — CID 82460000
5-amino-N-hexyl-1,3-dimethylpyrazole-4-sulfonamide (PubChem CID 82460000) has the molecular formula C11H22N4O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-amino-N-hexyl-1,3-dimethylpyrazole-4-sulfonamide.
| Compound Name | 5-amino-N-hexyl-1,3-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 82460000 |
| Molecular Formula | C11H22N4O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 5-amino-N-hexyl-1,3-dimethylpyrazole-4-sulfonamide |
| SMILES | CCCCCCNS(=O)(=O)c1c(C)nn(C)c1N |
| InChI | InChI=1S/C11H22N4O2S/c1-4-5-6-7-8-13-18(16,17)10-9(2)14-15(3)11(10)12/h13H,4-8,12H2,1-3H3 |
| InChIKey | IQDTWYMELIIAJI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|