About 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine
2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine (PubChem CID 82460595) has the molecular formula C13H21ClN4O
and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine |
| PubChem CID | 82460595 |
| Molecular Formula | C13H21ClN4O |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine |
| SMILES | Cc1nc(Cl)nc(NCCCN2CCOCC2)c1C |
| InChI | InChI=1S/C13H21ClN4O/c1-10-11(2)16-13(14)17-12(10)15-4-3-5-18-6-8-19-9-7-18/h3-9H2,1-2H3,(H,15,16,17) |
| InChIKey | SBQDKHKTEFCZTO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine?
The IUPAC name of 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine (CID 82460595) is 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine?
The canonical SMILES for 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine is Cc1nc(Cl)nc(NCCCN2CCOCC2)c1C.
What is the InChIKey of 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine?
The InChIKey is SBQDKHKTEFCZTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN4O/c1-10-11(2)16-13(14)17-12(10)15-4-3-5-18-6-8-19-9-7-18/h3-9H2,1-2H3,(H,15,16,17).
What are the key properties of 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine?
2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine has a molecular weight of 284.79 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5,6-dimethyl-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine is sourced from PubChem (CID 82460595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).