C20H31NO — CID 82462710
6,8-dimethyl-N-pentylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine (PubChem CID 82462710) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is 6,8-dimethyl-N-pentylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine.
| Compound Name | 6,8-dimethyl-N-pentylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine |
|---|---|
| PubChem CID | 82462710 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 6,8-dimethyl-N-pentylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine |
| SMILES | CCCCCNC1CC2(CCCC2)Oc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C20H31NO/c1-4-5-8-11-21-18-14-20(9-6-7-10-20)22-19-16(3)12-15(2)13-17(18)19/h12-13,18,21H,4-11,14H2,1-3H3 |
| InChIKey | VZCJZKNJJBCXFV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|