About 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine
4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine (PubChem CID 82463375) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine.
Molecular Properties
| Compound Name | 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine |
| PubChem CID | 82463375 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine |
| SMILES | CCn1c(C2CCNCC2)nc(C)c1C |
| InChI | InChI=1S/C12H21N3/c1-4-15-10(3)9(2)14-12(15)11-5-7-13-8-6-11/h11,13H,4-8H2,1-3H3 |
| InChIKey | WKSBHLAIEPINAG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine?
The IUPAC name of 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine (CID 82463375) is 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine.
What is the SMILES notation for 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine?
The canonical SMILES for 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine is CCn1c(C2CCNCC2)nc(C)c1C.
What is the InChIKey of 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine?
The InChIKey is WKSBHLAIEPINAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-4-15-10(3)9(2)14-12(15)11-5-7-13-8-6-11/h11,13H,4-8H2,1-3H3.
What are the key properties of 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine?
4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine has a molecular weight of 207.32 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-ethyl-4,5-dimethylimidazol-2-yl)piperidine is sourced from PubChem (CID 82463375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).