C11H13N5 — CID 82463462
3-(5-pyrrolidin-2-yl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 82463462) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 3-(5-pyrrolidin-2-yl-1H-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 3-(5-pyrrolidin-2-yl-1H-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 82463462 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-(5-pyrrolidin-2-yl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | c1cncc(-c2n[nH]c(C3CCCN3)n2)c1 |
| InChI | InChI=1S/C11H13N5/c1-3-8(7-12-5-1)10-14-11(16-15-10)9-4-2-6-13-9/h1,3,5,7,9,13H,2,4,6H2,(H,14,15,16) |
| InChIKey | HBACZVIIYAOEKF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |