About 3-bromo-1H-1,5-naphthyridin-4-one
3-bromo-1H-1,5-naphthyridin-4-one (PubChem CID 824639) has the molecular formula C8H5BrN2O
and a molecular weight of 225.05 g/mol. Its IUPAC name is 3-bromo-1H-1,5-naphthyridin-4-one.
Molecular Properties
| Compound Name | 3-bromo-1H-1,5-naphthyridin-4-one |
| PubChem CID | 824639 |
| Molecular Formula | C8H5BrN2O |
| Molecular Weight | 225.05 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 3-bromo-1H-1,5-naphthyridin-4-one |
| SMILES | O=c1c(Br)c[nH]c2cccnc12 |
| InChI | InChI=1S/C8H5BrN2O/c9-5-4-11-6-2-1-3-10-7(6)8(5)12/h1-4H,(H,11,12) |
| InChIKey | WFUHSKVVKSKPAI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.05 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-1H-1,5-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1H-1,5-naphthyridin-4-one?
The IUPAC name of 3-bromo-1H-1,5-naphthyridin-4-one (CID 824639) is 3-bromo-1H-1,5-naphthyridin-4-one.
What is the SMILES notation for 3-bromo-1H-1,5-naphthyridin-4-one?
The canonical SMILES for 3-bromo-1H-1,5-naphthyridin-4-one is O=c1c(Br)c[nH]c2cccnc12.
What is the InChIKey of 3-bromo-1H-1,5-naphthyridin-4-one?
The InChIKey is WFUHSKVVKSKPAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2O/c9-5-4-11-6-2-1-3-10-7(6)8(5)12/h1-4H,(H,11,12).
What are the key properties of 3-bromo-1H-1,5-naphthyridin-4-one?
3-bromo-1H-1,5-naphthyridin-4-one has a molecular weight of 225.05 g/mol, XLogP of 1.69, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1H-1,5-naphthyridin-4-one is sourced from PubChem (CID 824639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).