C14H23N5O2 — CID 82466297
1-(2-aminoethyl)-7-methyl-3,8-dipropylpurine-2,6-dione (PubChem CID 82466297) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-(2-aminoethyl)-7-methyl-3,8-dipropylpurine-2,6-dione.
| Compound Name | 1-(2-aminoethyl)-7-methyl-3,8-dipropylpurine-2,6-dione |
|---|---|
| PubChem CID | 82466297 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-(2-aminoethyl)-7-methyl-3,8-dipropylpurine-2,6-dione |
| SMILES | CCCc1nc2c(c(=O)n(CCN)c(=O)n2CCC)n1C |
| InChI | InChI=1S/C14H23N5O2/c1-4-6-10-16-12-11(17(10)3)13(20)19(9-7-15)14(21)18(12)8-5-2/h4-9,15H2,1-3H3 |
| InChIKey | OTNCBDNNGJHDHO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |