C12H18N2O — CID 82466701
3-amino-1-cyclopentyl-4,6-dimethylpyridin-2-one (PubChem CID 82466701) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-amino-1-cyclopentyl-4,6-dimethylpyridin-2-one.
| Compound Name | 3-amino-1-cyclopentyl-4,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 82466701 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-amino-1-cyclopentyl-4,6-dimethylpyridin-2-one |
| SMILES | Cc1cc(C)n(C2CCCC2)c(=O)c1N |
| InChI | InChI=1S/C12H18N2O/c1-8-7-9(2)14(12(15)11(8)13)10-5-3-4-6-10/h7,10H,3-6,13H2,1-2H3 |
| InChIKey | UERPSJGNGHMQJR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |