About 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine
2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine (PubChem CID 82467927) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine |
| PubChem CID | 82467927 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine |
| SMILES | NCCc1ncc2c(n1)CCC2 |
| InChI | InChI=1S/C9H13N3/c10-5-4-9-11-6-7-2-1-3-8(7)12-9/h6H,1-5,10H2 |
| InChIKey | FPRJIWIDCYPQNF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine?
The IUPAC name of 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine (CID 82467927) is 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine.
What is the SMILES notation for 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine?
The canonical SMILES for 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine is NCCc1ncc2c(n1)CCC2.
What is the InChIKey of 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine?
The InChIKey is FPRJIWIDCYPQNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c10-5-4-9-11-6-7-2-1-3-8(7)12-9/h6H,1-5,10H2.
What are the key properties of 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine?
2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine has a molecular weight of 163.22 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)ethanamine is sourced from PubChem (CID 82467927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).