C12H14N2O — CID 82469635
4-(2,4-dimethylphenyl)-5-methyl-1,2-oxazol-3-amine (PubChem CID 82469635) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-5-methyl-1,2-oxazol-3-amine.
| Compound Name | 4-(2,4-dimethylphenyl)-5-methyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 82469635 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-5-methyl-1,2-oxazol-3-amine |
| SMILES | Cc1ccc(-c2c(N)noc2C)c(C)c1 |
| InChI | InChI=1S/C12H14N2O/c1-7-4-5-10(8(2)6-7)11-9(3)15-14-12(11)13/h4-6H,1-3H3,(H2,13,14) |
| InChIKey | NIQLPMIKILSCJC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |