C9H13N3O3 — CID 82470813
2-(5-piperidin-1-yl-1,3,4-oxadiazol-2-yl)acetic acid (PubChem CID 82470813) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-(5-piperidin-1-yl-1,3,4-oxadiazol-2-yl)acetic acid.
| Compound Name | 2-(5-piperidin-1-yl-1,3,4-oxadiazol-2-yl)acetic acid |
|---|---|
| PubChem CID | 82470813 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-(5-piperidin-1-yl-1,3,4-oxadiazol-2-yl)acetic acid |
| SMILES | O=C(O)Cc1nnc(N2CCCCC2)o1 |
| InChI | InChI=1S/C9H13N3O3/c13-8(14)6-7-10-11-9(15-7)12-4-2-1-3-5-12/h1-6H2,(H,13,14) |
| InChIKey | ZUJNZCSOROGSSQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |