C13H16N2O — CID 82471529
N-(cyanomethyl)-2,3,5,6-tetramethylbenzamide (PubChem CID 82471529) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(cyanomethyl)-2,3,5,6-tetramethylbenzamide.
| Compound Name | N-(cyanomethyl)-2,3,5,6-tetramethylbenzamide |
|---|---|
| PubChem CID | 82471529 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-(cyanomethyl)-2,3,5,6-tetramethylbenzamide |
| SMILES | Cc1cc(C)c(C)c(C(=O)NCC#N)c1C |
| InChI | InChI=1S/C13H16N2O/c1-8-7-9(2)11(4)12(10(8)3)13(16)15-6-5-14/h7H,6H2,1-4H3,(H,15,16) |
| InChIKey | OUXQRGFZHVPWOQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|