C12H15N3O — CID 82471879
2-[(5-propan-2-yl-1,2,4-oxadiazol-3-yl)methyl]aniline (PubChem CID 82471879) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-[(5-propan-2-yl-1,2,4-oxadiazol-3-yl)methyl]aniline.
| Compound Name | 2-[(5-propan-2-yl-1,2,4-oxadiazol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 82471879 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-[(5-propan-2-yl-1,2,4-oxadiazol-3-yl)methyl]aniline |
| SMILES | CC(C)c1nc(Cc2ccccc2N)no1 |
| InChI | InChI=1S/C12H15N3O/c1-8(2)12-14-11(15-16-12)7-9-5-3-4-6-10(9)13/h3-6,8H,7,13H2,1-2H3 |
| InChIKey | AQMMKYMLEBVAKD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|