C11H10ClN3 — CID 82472496
3-chloro-2-N-phenylpyridine-2,5-diamine (PubChem CID 82472496) has the molecular formula C11H10ClN3 and a molecular weight of 219.68 g/mol. Its IUPAC name is 3-chloro-2-N-phenylpyridine-2,5-diamine.
| Compound Name | 3-chloro-2-N-phenylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 82472496 |
| Molecular Formula | C11H10ClN3 |
| Molecular Weight | 219.68 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 3-chloro-2-N-phenylpyridine-2,5-diamine |
| SMILES | Nc1cnc(Nc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C11H10ClN3/c12-10-6-8(13)7-14-11(10)15-9-4-2-1-3-5-9/h1-7H,13H2,(H,14,15) |
| InChIKey | RRVBHTXOIHFKPV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.68 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |