About 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine
5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine (PubChem CID 82476899) has the molecular formula C10H11FN4S
and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine |
| PubChem CID | 82476899 |
| Molecular Formula | C10H11FN4S |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(CCc2ccc(F)c(N)c2)s1 |
| InChI | InChI=1S/C10H11FN4S/c11-7-3-1-6(5-8(7)12)2-4-9-14-15-10(13)16-9/h1,3,5H,2,4,12H2,(H2,13,15) |
| InChIKey | PHPMYDMZPSPTDK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine (CID 82476899) is 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine is Nc1nnc(CCc2ccc(F)c(N)c2)s1.
What is the InChIKey of 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine?
The InChIKey is PHPMYDMZPSPTDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN4S/c11-7-3-1-6(5-8(7)12)2-4-9-14-15-10(13)16-9/h1,3,5H,2,4,12H2,(H2,13,15).
What are the key properties of 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine?
5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine has a molecular weight of 238.29 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3-amino-4-fluorophenyl)ethyl]-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 82476899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).