About 2,6-diphenoxypyridine
2,6-diphenoxypyridine (PubChem CID 824772) has the molecular formula C17H13NO2
and a molecular weight of 263.30 g/mol. Its IUPAC name is 2,6-diphenoxypyridine.
Molecular Properties
| Compound Name | 2,6-diphenoxypyridine |
| PubChem CID | 824772 |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2,6-diphenoxypyridine |
| SMILES | c1ccc(Oc2cccc(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H13NO2/c1-3-8-14(9-4-1)19-16-12-7-13-17(18-16)20-15-10-5-2-6-11-15/h1-13H |
| InChIKey | HNMMGGMSQSKUMF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-diphenoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diphenoxypyridine?
The IUPAC name of 2,6-diphenoxypyridine (CID 824772) is 2,6-diphenoxypyridine.
What is the SMILES notation for 2,6-diphenoxypyridine?
The canonical SMILES for 2,6-diphenoxypyridine is c1ccc(Oc2cccc(Oc3ccccc3)n2)cc1.
What is the InChIKey of 2,6-diphenoxypyridine?
The InChIKey is HNMMGGMSQSKUMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO2/c1-3-8-14(9-4-1)19-16-12-7-13-17(18-16)20-15-10-5-2-6-11-15/h1-13H.
What are the key properties of 2,6-diphenoxypyridine?
2,6-diphenoxypyridine has a molecular weight of 263.30 g/mol, XLogP of 4.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diphenoxypyridine is sourced from PubChem (CID 824772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).