C12H13ClO3 — CID 82477379
methyl 2-chloro-3-(2,5-dimethylphenyl)-3-oxopropanoate (PubChem CID 82477379) has the molecular formula C12H13ClO3 and a molecular weight of 240.69 g/mol. Its IUPAC name is methyl 2-chloro-3-(2,5-dimethylphenyl)-3-oxopropanoate.
| Compound Name | methyl 2-chloro-3-(2,5-dimethylphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 82477379 |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | methyl 2-chloro-3-(2,5-dimethylphenyl)-3-oxopropanoate |
| SMILES | COC(=O)C(Cl)C(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C12H13ClO3/c1-7-4-5-8(2)9(6-7)11(14)10(13)12(15)16-3/h4-6,10H,1-3H3 |
| InChIKey | RBBBIEDBHXJQCV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|