C16H22N2 — CID 82477892
N-[2-(1-methylindol-3-yl)ethyl]cyclopentanamine (PubChem CID 82477892) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-[2-(1-methylindol-3-yl)ethyl]cyclopentanamine.
| Compound Name | N-[2-(1-methylindol-3-yl)ethyl]cyclopentanamine |
|---|---|
| PubChem CID | 82477892 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-[2-(1-methylindol-3-yl)ethyl]cyclopentanamine |
| SMILES | Cn1cc(CCNC2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C16H22N2/c1-18-12-13(15-8-4-5-9-16(15)18)10-11-17-14-6-2-3-7-14/h4-5,8-9,12,14,17H,2-3,6-7,10-11H2,1H3 |
| InChIKey | RYDZFSXKONEHNF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |