About 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one
5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one (PubChem CID 82478007) has the molecular formula C13H13N3O2
and a molecular weight of 243.27 g/mol. Its IUPAC name is 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one.
Molecular Properties
| Compound Name | 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one |
| PubChem CID | 82478007 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2ccc(-c3cnoc3N)cc21 |
| InChI | InChI=1S/C13H13N3O2/c1-13(2)9-5-7(8-6-15-18-11(8)14)3-4-10(9)16-12(13)17/h3-6H,14H2,1-2H3,(H,16,17) |
| InChIKey | YLUSBRZEAGCFIT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one?
The IUPAC name of 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one (CID 82478007) is 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one.
What is the SMILES notation for 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one?
The canonical SMILES for 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one is CC1(C)C(=O)Nc2ccc(-c3cnoc3N)cc21.
What is the InChIKey of 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one?
The InChIKey is YLUSBRZEAGCFIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O2/c1-13(2)9-5-7(8-6-15-18-11(8)14)3-4-10(9)16-12(13)17/h3-6H,14H2,1-2H3,(H,16,17).
What are the key properties of 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one?
5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one has a molecular weight of 243.27 g/mol, XLogP of 2.15, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-amino-1,2-oxazol-4-yl)-3,3-dimethyl-1H-indol-2-one is sourced from PubChem (CID 82478007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).