C14H15NO3 — CID 82478865
2-[2-(2,4,6-trimethylphenyl)-1,3-oxazol-4-yl]acetic acid (PubChem CID 82478865) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-[2-(2,4,6-trimethylphenyl)-1,3-oxazol-4-yl]acetic acid.
| Compound Name | 2-[2-(2,4,6-trimethylphenyl)-1,3-oxazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 82478865 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-[2-(2,4,6-trimethylphenyl)-1,3-oxazol-4-yl]acetic acid |
| SMILES | Cc1cc(C)c(-c2nc(CC(=O)O)co2)c(C)c1 |
| InChI | InChI=1S/C14H15NO3/c1-8-4-9(2)13(10(3)5-8)14-15-11(7-18-14)6-12(16)17/h4-5,7H,6H2,1-3H3,(H,16,17) |
| InChIKey | HSTRMHCFVMMBOP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |