C13H15N3O2 — CID 82478923
[3-(2,5-dimethoxyphenyl)pyrazin-2-yl]methanamine (PubChem CID 82478923) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is [3-(2,5-dimethoxyphenyl)pyrazin-2-yl]methanamine.
| Compound Name | [3-(2,5-dimethoxyphenyl)pyrazin-2-yl]methanamine |
|---|---|
| PubChem CID | 82478923 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | [3-(2,5-dimethoxyphenyl)pyrazin-2-yl]methanamine |
| SMILES | COc1ccc(OC)c(-c2nccnc2CN)c1 |
| InChI | InChI=1S/C13H15N3O2/c1-17-9-3-4-12(18-2)10(7-9)13-11(8-14)15-5-6-16-13/h3-7H,8,14H2,1-2H3 |
| InChIKey | VDJPTDSVKFVTHK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |