About 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid
2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid (PubChem CID 82480575) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid.
Analyze 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid?
The IUPAC name of 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid (CID 82480575) is 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid.
What is the SMILES notation for 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid?
The canonical SMILES for 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid is Cc1cc(C)c(C(=O)CNC(C)C(=O)O)c(C)c1.
What is the InChIKey of 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid?
The InChIKey is AEQHSZYPPKNSCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-8-5-9(2)13(10(3)6-8)12(16)7-15-11(4)14(17)18/h5-6,11,15H,7H2,1-4H3,(H,17,18).
What are the key properties of 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid?
2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid has a molecular weight of 249.31 g/mol, XLogP of 1.86, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-oxo-2-(2,4,6-trimethylphenyl)ethyl]amino]propanoic acid is sourced from PubChem (CID 82480575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).