About 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone
2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 82480945) has the molecular formula C13H22N4O
and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone.
Molecular Properties
| Compound Name | 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone |
| PubChem CID | 82480945 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(c1cc[nH]c1)N1CCCN(C(=O)CN)CC1 |
| InChI | InChI=1S/C13H22N4O/c1-11(12-3-4-15-10-12)16-5-2-6-17(8-7-16)13(18)9-14/h3-4,10-11,15H,2,5-9,14H2,1H3 |
| InChIKey | YBSJZKMZROONBL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone?
The IUPAC name of 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone (CID 82480945) is 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone.
What is the SMILES notation for 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone?
The canonical SMILES for 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone is CC(c1cc[nH]c1)N1CCCN(C(=O)CN)CC1.
What is the InChIKey of 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone?
The InChIKey is YBSJZKMZROONBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O/c1-11(12-3-4-15-10-12)16-5-2-6-17(8-7-16)13(18)9-14/h3-4,10-11,15H,2,5-9,14H2,1H3.
What are the key properties of 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone?
2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone has a molecular weight of 250.35 g/mol, XLogP of 0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[4-[1-(1H-pyrrol-3-yl)ethyl]-1,4-diazepan-1-yl]ethanone is sourced from PubChem (CID 82480945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).