About 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one
6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one (PubChem CID 82480963) has the molecular formula C13H18N2OS
and a molecular weight of 250.37 g/mol. Its IUPAC name is 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one |
| PubChem CID | 82480963 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one |
| SMILES | CCC(C)(N)c1ccc2c(c1)NC(=O)C(C)S2 |
| InChI | InChI=1S/C13H18N2OS/c1-4-13(3,14)9-5-6-11-10(7-9)15-12(16)8(2)17-11/h5-8H,4,14H2,1-3H3,(H,15,16) |
| InChIKey | LGVMLRCIHKBAIR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one?
The IUPAC name of 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one (CID 82480963) is 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one is CCC(C)(N)c1ccc2c(c1)NC(=O)C(C)S2.
What is the InChIKey of 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one?
The InChIKey is LGVMLRCIHKBAIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2OS/c1-4-13(3,14)9-5-6-11-10(7-9)15-12(16)8(2)17-11/h5-8H,4,14H2,1-3H3,(H,15,16).
What are the key properties of 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one?
6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one has a molecular weight of 250.37 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-aminobutan-2-yl)-2-methyl-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 82480963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).