About CID 824813
CID 824813 (PubChem CID 824813) has the molecular formula C15H22S4
and a molecular weight of 330.61 g/mol.
Molecular Properties
| Compound Name | CID 824813 |
| PubChem CID | 824813 |
| Molecular Formula | C15H22S4 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | — |
| SMILES | C[C@@]12CCC3(C=C1CCCC21SCCS1)SCCS3 |
| InChI | InChI=1S/C15H22S4/c1-13-5-6-14(16-7-8-17-14)11-12(13)3-2-4-15(13)18-9-10-19-15/h11H,2-10H2,1H3/t13-/m1/s1 |
| InChIKey | PAUATRPREIQMBW-CYBMUJFWSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 824813 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 824813?
The IUPAC name of CID 824813 (CID 824813) is not available.
What is the SMILES notation for CID 824813?
The canonical SMILES for CID 824813 is C[C@@]12CCC3(C=C1CCCC21SCCS1)SCCS3.
What is the InChIKey of CID 824813?
The InChIKey is PAUATRPREIQMBW-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H22S4/c1-13-5-6-14(16-7-8-17-14)11-12(13)3-2-4-15(13)18-9-10-19-15/h11H,2-10H2,1H3/t13-/m1/s1.
What are the key properties of CID 824813?
CID 824813 has a molecular weight of 330.61 g/mol, XLogP of 5.25, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 824813 is sourced from PubChem (CID 824813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).