C9H5BrFN3 — CID 82481921
2-(3-bromo-4-fluorophenyl)-1,3,5-triazine (PubChem CID 82481921) has the molecular formula C9H5BrFN3 and a molecular weight of 254.06 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-1,3,5-triazine.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 82481921 |
| Molecular Formula | C9H5BrFN3 |
| Molecular Weight | 254.06 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-1,3,5-triazine |
| SMILES | Fc1ccc(-c2ncncn2)cc1Br |
| InChI | InChI=1S/C9H5BrFN3/c10-7-3-6(1-2-8(7)11)9-13-4-12-5-14-9/h1-5H |
| InChIKey | DOUKLSMQVFZFSI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.06 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |