C12H12N4OS — CID 82484613
2-(3-ethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-6-amine (PubChem CID 82484613) has the molecular formula C12H12N4OS and a molecular weight of 260.32 g/mol. Its IUPAC name is 2-(3-ethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-6-amine.
| Compound Name | 2-(3-ethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-6-amine |
|---|---|
| PubChem CID | 82484613 |
| Molecular Formula | C12H12N4OS |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-(3-ethoxyphenyl)imidazo[2,1-b][1,3,4]thiadiazol-6-amine |
| SMILES | CCOc1cccc(-c2nn3cc(N)nc3s2)c1 |
| InChI | InChI=1S/C12H12N4OS/c1-2-17-9-5-3-4-8(6-9)11-15-16-7-10(13)14-12(16)18-11/h3-7H,2,13H2,1H3 |
| InChIKey | LUNYCRHIIHUQMK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |