About 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline
3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline (PubChem CID 82484782) has the molecular formula C13H16N4S
and a molecular weight of 260.37 g/mol. Its IUPAC name is 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline |
| PubChem CID | 82484782 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline |
| SMILES | Nc1cccc(Cc2nnc(N3CCCC3)s2)c1 |
| InChI | InChI=1S/C13H16N4S/c14-11-5-3-4-10(8-11)9-12-15-16-13(18-12)17-6-1-2-7-17/h3-5,8H,1-2,6-7,9,14H2 |
| InChIKey | KTQKVQGTNVWRFY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline?
The IUPAC name of 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline (CID 82484782) is 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline.
What is the SMILES notation for 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline?
The canonical SMILES for 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline is Nc1cccc(Cc2nnc(N3CCCC3)s2)c1.
What is the InChIKey of 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline?
The InChIKey is KTQKVQGTNVWRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4S/c14-11-5-3-4-10(8-11)9-12-15-16-13(18-12)17-6-1-2-7-17/h3-5,8H,1-2,6-7,9,14H2.
What are the key properties of 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline?
3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline has a molecular weight of 260.37 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)methyl]aniline is sourced from PubChem (CID 82484782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).