C16H24N2O — CID 82484817
3-(3-methoxyphenyl)-3,9-diazaspiro[5.5]undecane (PubChem CID 82484817) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-(3-methoxyphenyl)-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 82484817 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-(3-methoxyphenyl)-3,9-diazaspiro[5.5]undecane |
| SMILES | COc1cccc(N2CCC3(CCNCC3)CC2)c1 |
| InChI | InChI=1S/C16H24N2O/c1-19-15-4-2-3-14(13-15)18-11-7-16(8-12-18)5-9-17-10-6-16/h2-4,13,17H,5-12H2,1H3 |
| InChIKey | DBPPMEDDXCGXDK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |