1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid

C16H23NO2 — CID 82485246

IUPAC1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid
SMILESCc1ccc(C)c(CCN2CCC(C(=O)O)CC2)c1
InChIInChI=1S/C16H23NO2/c1-12-3-4-13(2)15(11-12)7-10-17-8-5-14(6-9-17)16(18)19/h3-4,11,14H,5-10H2,1-2H3,(H,18,19)
InChIKeyXWVQOKICOQIEFY-UHFFFAOYSA-N
MW261.37 g/mol
LogP2.64
Rot. Bonds4

About 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid

1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid (PubChem CID 82485246) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid.

Molecular Properties

Compound Name1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid
PubChem CID82485246
Molecular FormulaC16H23NO2
Molecular Weight261.37 g/mol
Exact Mass261.17
IUPAC Name1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid
SMILESCc1ccc(C)c(CCN2CCC(C(=O)O)CC2)c1
InChIInChI=1S/C16H23NO2/c1-12-3-4-13(2)15(11-12)7-10-17-8-5-14(6-9-17)16(18)19/h3-4,11,14H,5-10H2,1-2H3,(H,18,19)
InChIKeyXWVQOKICOQIEFY-UHFFFAOYSA-N
XLogP2.64
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.37
LogP ≤ 52.64
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid?
The IUPAC name of 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid (CID 82485246) is 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid?
The canonical SMILES for 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid is Cc1ccc(C)c(CCN2CCC(C(=O)O)CC2)c1.
What is the InChIKey of 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid?
The InChIKey is XWVQOKICOQIEFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-12-3-4-13(2)15(11-12)7-10-17-8-5-14(6-9-17)16(18)19/h3-4,11,14H,5-10H2,1-2H3,(H,18,19).
What are the key properties of 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid?
1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid has a molecular weight of 261.37 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,5-dimethylphenyl)ethyl]piperidine-4-carboxylic acid is sourced from PubChem (CID 82485246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).