C17H19N3 — CID 82486748
2-[1-(2,5-dimethylphenyl)benzimidazol-2-yl]ethanamine (PubChem CID 82486748) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-[1-(2,5-dimethylphenyl)benzimidazol-2-yl]ethanamine.
| Compound Name | 2-[1-(2,5-dimethylphenyl)benzimidazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 82486748 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-[1-(2,5-dimethylphenyl)benzimidazol-2-yl]ethanamine |
| SMILES | Cc1ccc(C)c(-n2c(CCN)nc3ccccc32)c1 |
| InChI | InChI=1S/C17H19N3/c1-12-7-8-13(2)16(11-12)20-15-6-4-3-5-14(15)19-17(20)9-10-18/h3-8,11H,9-10,18H2,1-2H3 |
| InChIKey | CYSMJIFKASNPRE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |