About (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride
(E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride (PubChem CID 82487105) has the molecular formula C10H9ClF2O2S
and a molecular weight of 266.70 g/mol. Its IUPAC name is (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride |
| PubChem CID | 82487105 |
| Molecular Formula | C10H9ClF2O2S |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)CC/C=C/c1ccc(F)cc1F |
| InChI | InChI=1S/C10H9ClF2O2S/c11-16(14,15)6-2-1-3-8-4-5-9(12)7-10(8)13/h1,3-5,7H,2,6H2/b3-1+ |
| InChIKey | HKMOZSACSCSQHA-HNQUOIGGSA-N |
| XLogP | 2.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride?
The IUPAC name of (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride (CID 82487105) is (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride.
What is the SMILES notation for (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride?
The canonical SMILES for (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride is O=S(=O)(Cl)CC/C=C/c1ccc(F)cc1F.
What is the InChIKey of (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride?
The InChIKey is HKMOZSACSCSQHA-HNQUOIGGSA-N. The full InChI is InChI=1S/C10H9ClF2O2S/c11-16(14,15)6-2-1-3-8-4-5-9(12)7-10(8)13/h1,3-5,7H,2,6H2/b3-1+.
What are the key properties of (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride?
(E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride has a molecular weight of 266.70 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,4-difluorophenyl)but-3-ene-1-sulfonyl chloride is sourced from PubChem (CID 82487105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).