3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid

C12H9F2NO2S — CID 82487853

IUPAC3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid
SMILESO=C(O)CCc1cc(-c2ccc(F)c(F)c2)ns1
InChIInChI=1S/C12H9F2NO2S/c13-9-3-1-7(5-10(9)14)11-6-8(18-15-11)2-4-12(16)17/h1,3,5-6H,2,4H2,(H,16,17)
InChIKeyXBWZJPARRAEQNC-UHFFFAOYSA-N
MW269.27 g/mol
LogP3.11
Rot. Bonds4

About 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid

3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid (PubChem CID 82487853) has the molecular formula C12H9F2NO2S and a molecular weight of 269.27 g/mol. Its IUPAC name is 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid.

Molecular Properties

Compound Name3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid
PubChem CID82487853
Molecular FormulaC12H9F2NO2S
Molecular Weight269.27 g/mol
Exact Mass269.03
IUPAC Name3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid
SMILESO=C(O)CCc1cc(-c2ccc(F)c(F)c2)ns1
InChIInChI=1S/C12H9F2NO2S/c13-9-3-1-7(5-10(9)14)11-6-8(18-15-11)2-4-12(16)17/h1,3,5-6H,2,4H2,(H,16,17)
InChIKeyXBWZJPARRAEQNC-UHFFFAOYSA-N
XLogP3.11
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.27
LogP ≤ 53.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid?
The IUPAC name of 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid (CID 82487853) is 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid?
The canonical SMILES for 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid is O=C(O)CCc1cc(-c2ccc(F)c(F)c2)ns1.
What is the InChIKey of 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid?
The InChIKey is XBWZJPARRAEQNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2NO2S/c13-9-3-1-7(5-10(9)14)11-6-8(18-15-11)2-4-12(16)17/h1,3,5-6H,2,4H2,(H,16,17).
What are the key properties of 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid?
3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid has a molecular weight of 269.27 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3,4-difluorophenyl)-1,2-thiazol-5-yl]propanoic acid is sourced from PubChem (CID 82487853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).