About 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid
5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid (PubChem CID 82488584) has the molecular formula C16H20N2O2
and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid |
| PubChem CID | 82488584 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C)c(C(C)(C)c2cc(C(=O)O)n[nH]2)cc1C |
| InChI | InChI=1S/C16H20N2O2/c1-9-6-11(3)12(7-10(9)2)16(4,5)14-8-13(15(19)20)17-18-14/h6-8H,1-5H3,(H,17,18)(H,19,20) |
| InChIKey | QFWWDSJJNLKKMM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid?
The IUPAC name of 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid (CID 82488584) is 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid.
What is the SMILES notation for 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid?
The canonical SMILES for 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid is Cc1cc(C)c(C(C)(C)c2cc(C(=O)O)n[nH]2)cc1C.
What is the InChIKey of 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid?
The InChIKey is QFWWDSJJNLKKMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2/c1-9-6-11(3)12(7-10(9)2)16(4,5)14-8-13(15(19)20)17-18-14/h6-8H,1-5H3,(H,17,18)(H,19,20).
What are the key properties of 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid?
5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid has a molecular weight of 272.35 g/mol, XLogP of 3.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,4,5-trimethylphenyl)propan-2-yl]-1H-pyrazole-3-carboxylic acid is sourced from PubChem (CID 82488584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).