C12H14BrN3 — CID 82489297
2-[3-(4-bromophenyl)-5-methyl-1H-pyrazol-4-yl]ethanamine (PubChem CID 82489297) has the molecular formula C12H14BrN3 and a molecular weight of 280.17 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)-5-methyl-1H-pyrazol-4-yl]ethanamine.
| Compound Name | 2-[3-(4-bromophenyl)-5-methyl-1H-pyrazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 82489297 |
| Molecular Formula | C12H14BrN3 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-[3-(4-bromophenyl)-5-methyl-1H-pyrazol-4-yl]ethanamine |
| SMILES | Cc1[nH]nc(-c2ccc(Br)cc2)c1CCN |
| InChI | InChI=1S/C12H14BrN3/c1-8-11(6-7-14)12(16-15-8)9-2-4-10(13)5-3-9/h2-5H,6-7,14H2,1H3,(H,15,16) |
| InChIKey | QKXOFEFRQSZUTC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |