About methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate
methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate (PubChem CID 82489754) has the molecular formula C10H9BrClNO2
and a molecular weight of 290.54 g/mol. Its IUPAC name is methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate.
Molecular Properties
| Compound Name | methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate |
| PubChem CID | 82489754 |
| Molecular Formula | C10H9BrClNO2 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate |
| SMILES | COC(=O)N1CCc2cc(Br)cc(Cl)c21 |
| InChI | InChI=1S/C10H9BrClNO2/c1-15-10(14)13-3-2-6-4-7(11)5-8(12)9(6)13/h4-5H,2-3H2,1H3 |
| InChIKey | FLNSUFOTGURHFH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate?
The IUPAC name of methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate (CID 82489754) is methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate.
What is the SMILES notation for methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate?
The canonical SMILES for methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate is COC(=O)N1CCc2cc(Br)cc(Cl)c21.
What is the InChIKey of methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate?
The InChIKey is FLNSUFOTGURHFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrClNO2/c1-15-10(14)13-3-2-6-4-7(11)5-8(12)9(6)13/h4-5H,2-3H2,1H3.
What are the key properties of methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate?
methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate has a molecular weight of 290.54 g/mol, XLogP of 3.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-bromo-7-chloro-2,3-dihydroindole-1-carboxylate is sourced from PubChem (CID 82489754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).