C13H14BrNS — CID 82490061
2-[2-(2-bromophenyl)ethyl]-4,5-dimethyl-1,3-thiazole (PubChem CID 82490061) has the molecular formula C13H14BrNS and a molecular weight of 296.23 g/mol. Its IUPAC name is 2-[2-(2-bromophenyl)ethyl]-4,5-dimethyl-1,3-thiazole.
| Compound Name | 2-[2-(2-bromophenyl)ethyl]-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 82490061 |
| Molecular Formula | C13H14BrNS |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 2-[2-(2-bromophenyl)ethyl]-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(CCc2ccccc2Br)sc1C |
| InChI | InChI=1S/C13H14BrNS/c1-9-10(2)16-13(15-9)8-7-11-5-3-4-6-12(11)14/h3-6H,7-8H2,1-2H3 |
| InChIKey | SQQMUTIIBLRAGJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |