About 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole
7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole (PubChem CID 82490339) has the molecular formula C11H13BrClNO2S
and a molecular weight of 338.65 g/mol. Its IUPAC name is 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole.
Molecular Properties
| Compound Name | 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole |
| PubChem CID | 82490339 |
| Molecular Formula | C11H13BrClNO2S |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole |
| SMILES | CC1(C)CN(S(C)(=O)=O)c2c(Br)cc(Cl)cc21 |
| InChI | InChI=1S/C11H13BrClNO2S/c1-11(2)6-14(17(3,15)16)10-8(11)4-7(13)5-9(10)12/h4-5H,6H2,1-3H3 |
| InChIKey | WANSQZBGIRCHBK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole?
The IUPAC name of 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole (CID 82490339) is 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole.
What is the SMILES notation for 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole?
The canonical SMILES for 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole is CC1(C)CN(S(C)(=O)=O)c2c(Br)cc(Cl)cc21.
What is the InChIKey of 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole?
The InChIKey is WANSQZBGIRCHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrClNO2S/c1-11(2)6-14(17(3,15)16)10-8(11)4-7(13)5-9(10)12/h4-5H,6H2,1-3H3.
What are the key properties of 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole?
7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole has a molecular weight of 338.65 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-chloro-3,3-dimethyl-1-methylsulfonyl-2H-indole is sourced from PubChem (CID 82490339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).