C12H18N2O — CID 82492265
2-amino-N-[2-(3,4-dimethylphenyl)ethyl]acetamide (PubChem CID 82492265) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-amino-N-[2-(3,4-dimethylphenyl)ethyl]acetamide.
| Compound Name | 2-amino-N-[2-(3,4-dimethylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 82492265 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-amino-N-[2-(3,4-dimethylphenyl)ethyl]acetamide |
| SMILES | Cc1ccc(CCNC(=O)CN)cc1C |
| InChI | InChI=1S/C12H18N2O/c1-9-3-4-11(7-10(9)2)5-6-14-12(15)8-13/h3-4,7H,5-6,8,13H2,1-2H3,(H,14,15) |
| InChIKey | VOQJYQQYXUXNSB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |