C13H22N2 — CID 82492295
1-ethyl-2,5-dimethyl-3-(pyrrolidin-2-ylmethyl)pyrrole (PubChem CID 82492295) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-ethyl-2,5-dimethyl-3-(pyrrolidin-2-ylmethyl)pyrrole.
| Compound Name | 1-ethyl-2,5-dimethyl-3-(pyrrolidin-2-ylmethyl)pyrrole |
|---|---|
| PubChem CID | 82492295 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-ethyl-2,5-dimethyl-3-(pyrrolidin-2-ylmethyl)pyrrole |
| SMILES | CCn1c(C)cc(CC2CCCN2)c1C |
| InChI | InChI=1S/C13H22N2/c1-4-15-10(2)8-12(11(15)3)9-13-6-5-7-14-13/h8,13-14H,4-7,9H2,1-3H3 |
| InChIKey | SOFDKNUCSQJERH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |