C14H20N2 — CID 82493176
N-[2-(6-methyl-1H-indol-3-yl)ethyl]propan-2-amine (PubChem CID 82493176) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N-[2-(6-methyl-1H-indol-3-yl)ethyl]propan-2-amine.
| Compound Name | N-[2-(6-methyl-1H-indol-3-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 82493176 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-[2-(6-methyl-1H-indol-3-yl)ethyl]propan-2-amine |
| SMILES | Cc1ccc2c(CCNC(C)C)c[nH]c2c1 |
| InChI | InChI=1S/C14H20N2/c1-10(2)15-7-6-12-9-16-14-8-11(3)4-5-13(12)14/h4-5,8-10,15-16H,6-7H2,1-3H3 |
| InChIKey | JAQRETFWIOALBU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |